C33H45F2N3OS — CID 137137678
[3-(2-cycloheptylethylsulfanylamino)-2,6-difluorophenyl]-[5-(3-methylhepta-4,6-dienyl)-4-(C-methyl-N-propan-2-ylcarbonimidoyl)-1H-pyrrol-3-yl]methanone (PubChem CID 137137678) has the molecular formula C33H45F2N3OS and a molecular weight of 569.81 g/mol. Its IUPAC name is [3-(2-cycloheptylethylsulfanylamino)-2,6-difluorophenyl]-[5-(3-methylhepta-4,6-dienyl)-4-(C-methyl-N-propan-2-ylcarbonimidoyl)-1H-pyrrol-3-yl]methanone.
| Compound Name | [3-(2-cycloheptylethylsulfanylamino)-2,6-difluorophenyl]-[5-(3-methylhepta-4,6-dienyl)-4-(C-methyl-N-propan-2-ylcarbonimidoyl)-1H-pyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 137137678 |
| Molecular Formula | C33H45F2N3OS |
| Molecular Weight | 569.81 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | [3-(2-cycloheptylethylsulfanylamino)-2,6-difluorophenyl]-[5-(3-methylhepta-4,6-dienyl)-4-(C-methyl-N-propan-2-ylcarbonimidoyl)-1H-pyrrol-3-yl]methanone |
| SMILES | C=CC=CC(C)CCc1[nH]cc(C(=O)c2c(F)ccc(NSCCC3CCCCCC3)c2F)c1/C(C)=N/C(C)C |
| InChI | InChI=1S/C33H45F2N3OS/c1-6-7-12-23(4)15-17-28-30(24(5)37-22(2)3)26(21-36-28)33(39)31-27(34)16-18-29(32(31)35)38-40-20-19-25-13-10-8-9-11-14-25/h6-7,12,16,18,21-23,25,36,38H,1,8-11,13-15,17,19-20H2,2-5H3/b12-7?,37-24+ |
| InChIKey | LPFYXGITMHBFKM-YLOQEVCBSA-N |
| XLogP | 9.47 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.81 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|