C18H26F2N2O — CID 173222725
3-cyclohexyl-N-[(2S)-1-(2,5-difluoroanilino)propan-2-yl]propanamide (PubChem CID 173222725) has the molecular formula C18H26F2N2O and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(2S)-1-(2,5-difluoroanilino)propan-2-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[(2S)-1-(2,5-difluoroanilino)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 173222725 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-cyclohexyl-N-[(2S)-1-(2,5-difluoroanilino)propan-2-yl]propanamide |
| SMILES | C[C@@H](CNc1cc(F)ccc1F)NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C18H26F2N2O/c1-13(12-21-17-11-15(19)8-9-16(17)20)22-18(23)10-7-14-5-3-2-4-6-14/h8-9,11,13-14,21H,2-7,10,12H2,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | GFQSPFLLXXYRNO-ZDUSSCGKSA-N |
| XLogP | 4.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |