C25H39ClFN3O3S — CID 143425510
N-[4-[(2-chloro-4-fluorophenyl)sulfinylamino]butyl]-2-(3-cyclohexylpropanoylamino)-4-methylpentanamide (PubChem CID 143425510) has the molecular formula C25H39ClFN3O3S and a molecular weight of 516.12 g/mol. Its IUPAC name is N-[4-[(2-chloro-4-fluorophenyl)sulfinylamino]butyl]-2-(3-cyclohexylpropanoylamino)-4-methylpentanamide.
| Compound Name | N-[4-[(2-chloro-4-fluorophenyl)sulfinylamino]butyl]-2-(3-cyclohexylpropanoylamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 143425510 |
| Molecular Formula | C25H39ClFN3O3S |
| Molecular Weight | 516.12 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | N-[4-[(2-chloro-4-fluorophenyl)sulfinylamino]butyl]-2-(3-cyclohexylpropanoylamino)-4-methylpentanamide |
| SMILES | CC(C)CC(NC(=O)CCC1CCCCC1)C(=O)NCCCCNS(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C25H39ClFN3O3S/c1-18(2)16-22(30-24(31)13-10-19-8-4-3-5-9-19)25(32)28-14-6-7-15-29-34(33)23-12-11-20(27)17-21(23)26/h11-12,17-19,22,29H,3-10,13-16H2,1-2H3,(H,28,32)(H,30,31) |
| InChIKey | XVGJKXKUHZQHAA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|