C26H41ClFN3O4S — CID 11526778
(2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(5-cyclohexylpentanoylamino)-4-methylpentanamide (PubChem CID 11526778) has the molecular formula C26H41ClFN3O4S and a molecular weight of 546.15 g/mol. Its IUPAC name is (2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(5-cyclohexylpentanoylamino)-4-methylpentanamide.
| Compound Name | (2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(5-cyclohexylpentanoylamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 11526778 |
| Molecular Formula | C26H41ClFN3O4S |
| Molecular Weight | 546.15 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | (2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(5-cyclohexylpentanoylamino)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)CCCCC1CCCCC1)C(=O)NCCCNS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C26H41ClFN3O4S/c1-19(2)17-23(31-25(32)12-7-6-11-20-9-4-3-5-10-20)26(33)29-15-8-16-30-36(34,35)24-14-13-21(28)18-22(24)27/h13-14,18-20,23,30H,3-12,15-17H2,1-2H3,(H,29,33)(H,31,32)/t23-/m0/s1 |
| InChIKey | LXKKQNVYLUUAKE-QHCPKHFHSA-N |
| XLogP | 4.94 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.15 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|