C24H35ClFN3O5S — CID 163484743
cyclohexylmethyl N-[(E)-1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]butylamino]-4-methyl-1-oxopent-2-en-2-yl]carbamate (PubChem CID 163484743) has the molecular formula C24H35ClFN3O5S and a molecular weight of 532.08 g/mol. Its IUPAC name is cyclohexylmethyl N-[(E)-1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]butylamino]-4-methyl-1-oxopent-2-en-2-yl]carbamate.
| Compound Name | cyclohexylmethyl N-[(E)-1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]butylamino]-4-methyl-1-oxopent-2-en-2-yl]carbamate |
|---|---|
| PubChem CID | 163484743 |
| Molecular Formula | C24H35ClFN3O5S |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | cyclohexylmethyl N-[(E)-1-[4-[(2-chloro-4-fluorophenyl)sulfonylamino]butylamino]-4-methyl-1-oxopent-2-en-2-yl]carbamate |
| SMILES | CC(C)/C=C(/NC(=O)OCC1CCCCC1)C(=O)NCCCCNS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H35ClFN3O5S/c1-17(2)14-21(29-24(31)34-16-18-8-4-3-5-9-18)23(30)27-12-6-7-13-28-35(32,33)22-11-10-19(26)15-20(22)25/h10-11,14-15,17-18,28H,3-9,12-13,16H2,1-2H3,(H,27,30)(H,29,31)/b21-14+ |
| InChIKey | CHPVPMVOLVSKTH-KGENOOAVSA-N |
| XLogP | 4.50 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|