C21H31ClFN3O4S — CID 11576514
(2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(3-cyclopropylpropanoylamino)-4-methylpentanamide (PubChem CID 11576514) has the molecular formula C21H31ClFN3O4S and a molecular weight of 476.01 g/mol. Its IUPAC name is (2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(3-cyclopropylpropanoylamino)-4-methylpentanamide.
| Compound Name | (2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(3-cyclopropylpropanoylamino)-4-methylpentanamide |
|---|---|
| PubChem CID | 11576514 |
| Molecular Formula | C21H31ClFN3O4S |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (2S)-N-[3-[(2-chloro-4-fluorophenyl)sulfonylamino]propyl]-2-(3-cyclopropylpropanoylamino)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)CCC1CC1)C(=O)NCCCNS(=O)(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H31ClFN3O4S/c1-14(2)12-18(26-20(27)9-6-15-4-5-15)21(28)24-10-3-11-25-31(29,30)19-8-7-16(23)13-17(19)22/h7-8,13-15,18,25H,3-6,9-12H2,1-2H3,(H,24,28)(H,26,27)/t18-/m0/s1 |
| InChIKey | WWLTXYGIYKAPQK-SFHVURJKSA-N |
| XLogP | 2.98 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|