C19H16N4O — CID 167374731
N-[2-(2-isocyanophenyl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide (PubChem CID 167374731) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[2-(2-isocyanophenyl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide.
| Compound Name | N-[2-(2-isocyanophenyl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167374731 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[2-(2-isocyanophenyl)-1-methylpyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide |
| SMILES | [C-]#[N+]c1ccccc1-c1cc2cc(NC(=O)C3CC3)ncc2n1C |
| InChI | InChI=1S/C19H16N4O/c1-20-15-6-4-3-5-14(15)16-9-13-10-18(21-11-17(13)23(16)2)22-19(24)12-7-8-12/h3-6,9-12H,7-8H2,2H3,(H,21,22,24) |
| InChIKey | ZOFYZYJWTQOTJM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|