C18H28ClN3O3SSi — CID 153456176
3-[5-chloro-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 153456176) has the molecular formula C18H28ClN3O3SSi and a molecular weight of 430.05 g/mol. Its IUPAC name is 3-[5-chloro-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[5-chloro-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 153456176 |
| Molecular Formula | C18H28ClN3O3SSi |
| Molecular Weight | 430.05 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 3-[5-chloro-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c(Cl)c1-c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H28ClN3O3SSi/c1-14-17(15-8-7-9-16(12-15)26(23,24)21(2)3)18(19)22(20-14)13-25-10-11-27(4,5)6/h7-9,12H,10-11,13H2,1-6H3 |
| InChIKey | WEPUZKZSKFEAFT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.05 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|