C17H28N4OSi — CID 167527527
5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 167527527) has the molecular formula C17H28N4OSi and a molecular weight of 332.52 g/mol. Its IUPAC name is 5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 167527527 |
| Molecular Formula | C17H28N4OSi |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 5-[5-ethyl-3-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | CCc1c(-c2ccc(N)nc2)c(C)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C17H28N4OSi/c1-6-15-17(14-7-8-16(18)19-11-14)13(2)20-21(15)12-22-9-10-23(3,4)5/h7-8,11H,6,9-10,12H2,1-5H3,(H2,18,19) |
| InChIKey | MFUBMUMEILNPBP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|