C20H20F4O5S2 — CID 118456610
2-[(5-fluoro-2-methylsulfonylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane (PubChem CID 118456610) has the molecular formula C20H20F4O5S2 and a molecular weight of 480.50 g/mol. Its IUPAC name is 2-[(5-fluoro-2-methylsulfonylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane.
| Compound Name | 2-[(5-fluoro-2-methylsulfonylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
|---|---|
| PubChem CID | 118456610 |
| Molecular Formula | C20H20F4O5S2 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-[(5-fluoro-2-methylsulfonylphenyl)methyl]-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| SMILES | CS(=O)(=O)c1ccc(F)cc1CC1CC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C20H20F4O5S2/c1-30(25,26)19-6-5-15(21)9-13(19)10-16-12-18(7-8-29-16)31(27,28)17-4-2-3-14(11-17)20(22,23)24/h2-6,9,11,16,18H,7-8,10,12H2,1H3 |
| InChIKey | NBHNCNSWJHJHTD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |