C19H18ClF3O3S — CID 118456643
2-(4-chlorophenyl)-4-methyl-3-[3-(trifluoromethyl)phenyl]sulfonyloxane (PubChem CID 118456643) has the molecular formula C19H18ClF3O3S and a molecular weight of 418.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-methyl-3-[3-(trifluoromethyl)phenyl]sulfonyloxane.
| Compound Name | 2-(4-chlorophenyl)-4-methyl-3-[3-(trifluoromethyl)phenyl]sulfonyloxane |
|---|---|
| PubChem CID | 118456643 |
| Molecular Formula | C19H18ClF3O3S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 2-(4-chlorophenyl)-4-methyl-3-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| SMILES | CC1CCOC(c2ccc(Cl)cc2)C1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18ClF3O3S/c1-12-9-10-26-17(13-5-7-15(20)8-6-13)18(12)27(24,25)16-4-2-3-14(11-16)19(21,22)23/h2-8,11-12,17-18H,9-10H2,1H3 |
| InChIKey | UQPUXVYEHQQGTP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |