C21H21ClF3NO5S2 — CID 51041139
4-chloro-2-methylsulfonyl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]benzamide (PubChem CID 51041139) has the molecular formula C21H21ClF3NO5S2 and a molecular weight of 523.98 g/mol. Its IUPAC name is 4-chloro-2-methylsulfonyl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]benzamide.
| Compound Name | 4-chloro-2-methylsulfonyl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 51041139 |
| Molecular Formula | C21H21ClF3NO5S2 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 4-chloro-2-methylsulfonyl-N-[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]benzamide |
| SMILES | CS(=O)(=O)c1cc(Cl)ccc1C(=O)NC1CCC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H21ClF3NO5S2/c1-32(28,29)19-12-14(22)5-10-18(19)20(27)26-15-6-8-16(9-7-15)33(30,31)17-4-2-3-13(11-17)21(23,24)25/h2-5,10-12,15-16H,6-9H2,1H3,(H,26,27) |
| InChIKey | NDFUBRRKTZGJNU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |