C17H14ClF3N2O3S — CID 26965393
2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-cyclopropylbenzamide (PubChem CID 26965393) has the molecular formula C17H14ClF3N2O3S and a molecular weight of 418.82 g/mol. Its IUPAC name is 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-cyclopropylbenzamide.
| Compound Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 26965393 |
| Molecular Formula | C17H14ClF3N2O3S |
| Molecular Weight | 418.82 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccccc1NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H14ClF3N2O3S/c18-13-8-5-10(17(19,20)21)9-15(13)27(25,26)23-14-4-2-1-3-12(14)16(24)22-11-6-7-11/h1-5,8-9,11,23H,6-7H2,(H,22,24) |
| InChIKey | JBDSEAYBHLPAAF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |