C18H15BrClF3O3S — CID 118432440
4-[2-bromo-5-(trifluoromethyl)phenyl]sulfonyl-2-(4-chlorophenyl)oxane (PubChem CID 118432440) has the molecular formula C18H15BrClF3O3S and a molecular weight of 483.73 g/mol. Its IUPAC name is 4-[2-bromo-5-(trifluoromethyl)phenyl]sulfonyl-2-(4-chlorophenyl)oxane.
| Compound Name | 4-[2-bromo-5-(trifluoromethyl)phenyl]sulfonyl-2-(4-chlorophenyl)oxane |
|---|---|
| PubChem CID | 118432440 |
| Molecular Formula | C18H15BrClF3O3S |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 481.96 |
| IUPAC Name | 4-[2-bromo-5-(trifluoromethyl)phenyl]sulfonyl-2-(4-chlorophenyl)oxane |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)ccc1Br)C1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H15BrClF3O3S/c19-15-6-3-12(18(21,22)23)9-17(15)27(24,25)14-7-8-26-16(10-14)11-1-4-13(20)5-2-11/h1-6,9,14,16H,7-8,10H2 |
| InChIKey | QYXDBFAZBVZWHB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |