C17H15ClF3NO2S — CID 138712102
5-chloro-2-[4-[3-(trifluoromethyl)phenyl]sulfinyloxan-2-yl]pyridine (PubChem CID 138712102) has the molecular formula C17H15ClF3NO2S and a molecular weight of 389.83 g/mol. Its IUPAC name is 5-chloro-2-[4-[3-(trifluoromethyl)phenyl]sulfinyloxan-2-yl]pyridine.
| Compound Name | 5-chloro-2-[4-[3-(trifluoromethyl)phenyl]sulfinyloxan-2-yl]pyridine |
|---|---|
| PubChem CID | 138712102 |
| Molecular Formula | C17H15ClF3NO2S |
| Molecular Weight | 389.83 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 5-chloro-2-[4-[3-(trifluoromethyl)phenyl]sulfinyloxan-2-yl]pyridine |
| SMILES | O=S(c1cccc(C(F)(F)F)c1)C1CCOC(c2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C17H15ClF3NO2S/c18-12-4-5-15(22-10-12)16-9-14(6-7-24-16)25(23)13-3-1-2-11(8-13)17(19,20)21/h1-5,8,10,14,16H,6-7,9H2 |
| InChIKey | SZPKPACSMPYUEC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |