C7H5F3NaO2S — CID 53444038
CID 53444038 (PubChem CID 53444038) has the molecular formula C7H5F3NaO2S and a molecular weight of 233.17 g/mol.
| Compound Name | CID 53444038 |
|---|---|
| PubChem CID | 53444038 |
| Molecular Formula | C7H5F3NaO2S |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | — |
| SMILES | O=S(O)c1cccc(C(F)(F)F)c1.[Na] |
| InChI | InChI=1S/C7H5F3O2S.Na/c8-7(9,10)5-2-1-3-6(4-5)13(11)12;/h1-4H,(H,11,12); |
| InChIKey | MEJZLKVJSXUPOA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|