C17H18F3NOS — CID 22358264
N-tert-butyl-4-[3-(trifluoromethyl)phenyl]sulfinylaniline (PubChem CID 22358264) has the molecular formula C17H18F3NOS and a molecular weight of 341.40 g/mol. Its IUPAC name is N-tert-butyl-4-[3-(trifluoromethyl)phenyl]sulfinylaniline.
| Compound Name | N-tert-butyl-4-[3-(trifluoromethyl)phenyl]sulfinylaniline |
|---|---|
| PubChem CID | 22358264 |
| Molecular Formula | C17H18F3NOS |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-tert-butyl-4-[3-(trifluoromethyl)phenyl]sulfinylaniline |
| SMILES | CC(C)(C)Nc1ccc(S(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H18F3NOS/c1-16(2,3)21-13-7-9-14(10-8-13)23(22)15-6-4-5-12(11-15)17(18,19)20/h4-11,21H,1-3H3 |
| InChIKey | DDDSMTFIUPGFKS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |