C13H5F15O2S — CID 89202022
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzenesulfinic acid (PubChem CID 89202022) has the molecular formula C13H5F15O2S and a molecular weight of 510.22 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzenesulfinic acid.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzenesulfinic acid |
|---|---|
| PubChem CID | 89202022 |
| Molecular Formula | C13H5F15O2S |
| Molecular Weight | 510.22 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzenesulfinic acid |
| SMILES | O=S(O)c1cccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H5F15O2S/c14-7(15,5-2-1-3-6(4-5)31(29)30)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h1-4H,(H,29,30) |
| InChIKey | JLMIMRYBFIUQJI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.22 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|