C16H4F17NO3 — CID 24970593
5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-hydroxyisoindole-1,3-dione (PubChem CID 24970593) has the molecular formula C16H4F17NO3 and a molecular weight of 581.18 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-hydroxyisoindole-1,3-dione.
| Compound Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 24970593 |
| Molecular Formula | C16H4F17NO3 |
| Molecular Weight | 581.18 g/mol |
| Exact Mass | 580.99 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-hydroxyisoindole-1,3-dione |
| SMILES | O=C1c2ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2C(=O)N1O |
| InChI | InChI=1S/C16H4F17NO3/c17-9(18,4-1-2-5-6(3-4)8(36)34(37)7(5)35)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h1-3,37H |
| InChIKey | UGXFGBSLQOWQDG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.18 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|