C10H5F10N — CID 131953311
2-fluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline (PubChem CID 131953311) has the molecular formula C10H5F10N and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-fluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline.
| Compound Name | 2-fluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
|---|---|
| PubChem CID | 131953311 |
| Molecular Formula | C10H5F10N |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-fluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
| SMILES | Nc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1F |
| InChI | InChI=1S/C10H5F10N/c11-5-2-1-4(3-6(5)21)7(12,13)8(14,15)9(16,17)10(18,19)20/h1-3H,21H2 |
| InChIKey | RUFJCCYAEICMBP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|