C18H12F12N2 — CID 169274864
4-[6-(4-aminophenyl)-1,1,1,2,2,3,4,4,5,5,6,6-dodecafluorohexan-3-yl]aniline (PubChem CID 169274864) has the molecular formula C18H12F12N2 and a molecular weight of 484.28 g/mol. Its IUPAC name is 4-[6-(4-aminophenyl)-1,1,1,2,2,3,4,4,5,5,6,6-dodecafluorohexan-3-yl]aniline.
| Compound Name | 4-[6-(4-aminophenyl)-1,1,1,2,2,3,4,4,5,5,6,6-dodecafluorohexan-3-yl]aniline |
|---|---|
| PubChem CID | 169274864 |
| Molecular Formula | C18H12F12N2 |
| Molecular Weight | 484.28 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 4-[6-(4-aminophenyl)-1,1,1,2,2,3,4,4,5,5,6,6-dodecafluorohexan-3-yl]aniline |
| SMILES | Nc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(c2ccc(N)cc2)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F12N2/c19-13(16(24,25)18(28,29)30,9-1-5-11(31)6-2-9)15(22,23)17(26,27)14(20,21)10-3-7-12(32)8-4-10/h1-8H,31-32H2 |
| InChIKey | YIKXYFTYMUKNPQ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.28 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|