C18H13F14IN2 — CID 157238423
aniline;1,1,1,2,3,3,3-heptafluoro-2-iodopropane;4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline (PubChem CID 157238423) has the molecular formula C18H13F14IN2 and a molecular weight of 650.19 g/mol. Its IUPAC name is aniline;1,1,1,2,3,3,3-heptafluoro-2-iodopropane;4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline.
| Compound Name | aniline;1,1,1,2,3,3,3-heptafluoro-2-iodopropane;4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
|---|---|
| PubChem CID | 157238423 |
| Molecular Formula | C18H13F14IN2 |
| Molecular Weight | 650.19 g/mol |
| Exact Mass | 649.99 |
| IUPAC Name | aniline;1,1,1,2,3,3,3-heptafluoro-2-iodopropane;4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
| SMILES | FC(F)(F)C(F)(I)C(F)(F)F.Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1.Nc1ccccc1 |
| InChI | InChI=1S/C9H6F7N.C6H7N.C3F7I/c10-7(8(11,12)13,9(14,15)16)5-1-3-6(17)4-2-5;7-6-4-2-1-3-5-6;4-1(11,2(5,6)7)3(8,9)10/h1-4H,17H2;1-5H,7H2; |
| InChIKey | AUXNICKCECNOEP-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.19 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|