About benzene;4-tert-butylaniline
benzene;4-tert-butylaniline (PubChem CID 175140068) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is benzene;4-tert-butylaniline.
Molecular Properties
| Compound Name | benzene;4-tert-butylaniline |
| PubChem CID | 175140068 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | benzene;4-tert-butylaniline |
| SMILES | CC(C)(C)c1ccc(N)cc1.c1ccccc1 |
| InChI | InChI=1S/C10H15N.C6H6/c1-10(2,3)8-4-6-9(11)7-5-8;1-2-4-6-5-3-1/h4-7H,11H2,1-3H3;1-6H |
| InChIKey | SUKDZVMDNKEMNJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene;4-tert-butylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-tert-butylaniline?
The IUPAC name of benzene;4-tert-butylaniline (CID 175140068) is benzene;4-tert-butylaniline.
What is the SMILES notation for benzene;4-tert-butylaniline?
The canonical SMILES for benzene;4-tert-butylaniline is CC(C)(C)c1ccc(N)cc1.c1ccccc1.
What is the InChIKey of benzene;4-tert-butylaniline?
The InChIKey is SUKDZVMDNKEMNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C6H6/c1-10(2,3)8-4-6-9(11)7-5-8;1-2-4-6-5-3-1/h4-7H,11H2,1-3H3;1-6H.
What are the key properties of benzene;4-tert-butylaniline?
benzene;4-tert-butylaniline has a molecular weight of 227.35 g/mol, XLogP of 4.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-tert-butylaniline is sourced from PubChem (CID 175140068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).