C24H30N4 — CID 57264580
3,6-bis[2-(4-aminophenyl)propan-2-yl]benzene-1,2-diamine (PubChem CID 57264580) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is 3,6-bis[2-(4-aminophenyl)propan-2-yl]benzene-1,2-diamine.
| Compound Name | 3,6-bis[2-(4-aminophenyl)propan-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 57264580 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 3,6-bis[2-(4-aminophenyl)propan-2-yl]benzene-1,2-diamine |
| SMILES | CC(C)(c1ccc(N)cc1)c1ccc(C(C)(C)c2ccc(N)cc2)c(N)c1N |
| InChI | InChI=1S/C24H30N4/c1-23(2,15-5-9-17(25)10-6-15)19-13-14-20(22(28)21(19)27)24(3,4)16-7-11-18(26)12-8-16/h5-14H,25-28H2,1-4H3 |
| InChIKey | VVVOIYPVUNNVJP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|