C11H8F9N — CID 164681997
4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline (PubChem CID 164681997) has the molecular formula C11H8F9N and a molecular weight of 325.17 g/mol. Its IUPAC name is 4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline.
| Compound Name | 4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
|---|---|
| PubChem CID | 164681997 |
| Molecular Formula | C11H8F9N |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 4-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)aniline |
| SMILES | Cc1ccc(N)c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H8F9N/c1-5-2-3-7(21)6(4-5)8(12,13)9(14,15)10(16,17)11(18,19)20/h2-4H,21H2,1H3 |
| InChIKey | XEAPKCGZYNTEJO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|