C10H7F7O3S — CID 87154994
2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylbenzenesulfonic acid (PubChem CID 87154994) has the molecular formula C10H7F7O3S and a molecular weight of 340.22 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylbenzenesulfonic acid.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87154994 |
| Molecular Formula | C10H7F7O3S |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F7O3S/c1-5-2-3-7(21(18,19)20)6(4-5)8(11,12)9(13,14)10(15,16)17/h2-4H,1H3,(H,18,19,20) |
| InChIKey | ZYMQEYHDNZLIHG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|