C16H15F5N2O — CID 163915744
4-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2,6-dimethylaniline (PubChem CID 163915744) has the molecular formula C16H15F5N2O and a molecular weight of 346.30 g/mol. Its IUPAC name is 4-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2,6-dimethylaniline.
| Compound Name | 4-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 163915744 |
| Molecular Formula | C16H15F5N2O |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-[4-amino-3-(1,1,2,2,2-pentafluoroethyl)phenoxy]-2,6-dimethylaniline |
| SMILES | Cc1cc(Oc2ccc(N)c(C(F)(F)C(F)(F)F)c2)cc(C)c1N |
| InChI | InChI=1S/C16H15F5N2O/c1-8-5-11(6-9(2)14(8)23)24-10-3-4-13(22)12(7-10)15(17,18)16(19,20)21/h3-7H,22-23H2,1-2H3 |
| InChIKey | QWBVTCMKNYTCHY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|