C13H6F13NO2 — CID 177495620
6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-benzodioxol-5-amine (PubChem CID 177495620) has the molecular formula C13H6F13NO2 and a molecular weight of 455.17 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-benzodioxol-5-amine.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 177495620 |
| Molecular Formula | C13H6F13NO2 |
| Molecular Weight | 455.17 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1,3-benzodioxol-5-amine |
| SMILES | Nc1cc2c(cc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCO2 |
| InChI | InChI=1S/C13H6F13NO2/c14-8(15,4-1-6-7(2-5(4)27)29-3-28-6)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h1-2H,3,27H2 |
| InChIKey | PMXFLTSLRKDUAJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.17 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|