C9H7ClF2O3 — CID 105424288
2-(6-chloro-1,3-benzodioxol-5-yl)-2,2-difluoroethanol (PubChem CID 105424288) has the molecular formula C9H7ClF2O3 and a molecular weight of 236.60 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzodioxol-5-yl)-2,2-difluoroethanol.
| Compound Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 105424288 |
| Molecular Formula | C9H7ClF2O3 |
| Molecular Weight | 236.60 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2,2-difluoroethanol |
| SMILES | OCC(F)(F)c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C9H7ClF2O3/c10-6-2-8-7(14-4-15-8)1-5(6)9(11,12)3-13/h1-2,13H,3-4H2 |
| InChIKey | GXJOCWYFLGHSFV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |