C10H10ClFO3 — CID 105424287
2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropan-1-ol (PubChem CID 105424287) has the molecular formula C10H10ClFO3 and a molecular weight of 232.64 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropan-1-ol.
| Compound Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropan-1-ol |
|---|---|
| PubChem CID | 105424287 |
| Molecular Formula | C10H10ClFO3 |
| Molecular Weight | 232.64 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropan-1-ol |
| SMILES | CC(F)(CO)c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C10H10ClFO3/c1-10(12,4-13)6-2-8-9(3-7(6)11)15-5-14-8/h2-3,13H,4-5H2,1H3 |
| InChIKey | IEPRZXLGIITIEN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |