C10H8ClFO4 — CID 105424271
2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropanoic acid (PubChem CID 105424271) has the molecular formula C10H8ClFO4 and a molecular weight of 246.62 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropanoic acid.
| Compound Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 105424271 |
| Molecular Formula | C10H8ClFO4 |
| Molecular Weight | 246.62 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2-fluoropropanoic acid |
| SMILES | CC(F)(C(=O)O)c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C10H8ClFO4/c1-10(12,9(13)14)5-2-7-8(3-6(5)11)16-4-15-7/h2-3H,4H2,1H3,(H,13,14) |
| InChIKey | RAHFUGSXUITLBI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.62 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |