C11H14ClNO2 — CID 105424248
2-(6-chloro-1,3-benzodioxol-5-yl)-2-methylpropan-1-amine (PubChem CID 105424248) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzodioxol-5-yl)-2-methylpropan-1-amine.
| Compound Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 105424248 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-(6-chloro-1,3-benzodioxol-5-yl)-2-methylpropan-1-amine |
| SMILES | CC(C)(CN)c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C11H14ClNO2/c1-11(2,5-13)7-3-9-10(4-8(7)12)15-6-14-9/h3-4H,5-6,13H2,1-2H3 |
| InChIKey | QDWQNANRJGUNGY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |