C11H6ClF7N2O2 — CID 126040550
N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine (PubChem CID 126040550) has the molecular formula C11H6ClF7N2O2 and a molecular weight of 366.62 g/mol. Its IUPAC name is N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine.
| Compound Name | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
|---|---|
| PubChem CID | 126040550 |
| Molecular Formula | C11H6ClF7N2O2 |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1,1,2,2,3,3,3-heptafluoropropan-1-amine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)N/N=C\c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C11H6ClF7N2O2/c12-6-2-8-7(22-4-23-8)1-5(6)3-20-21-11(18,19)9(13,14)10(15,16)17/h1-3,21H,4H2/b20-3- |
| InChIKey | NFABJAKIXGLXMR-DYUKFFQPSA-N |
| XLogP | 3.78 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|