C16H11ClN4O2 — CID 6148660
N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]phthalazin-1-amine (PubChem CID 6148660) has the molecular formula C16H11ClN4O2 and a molecular weight of 326.74 g/mol. Its IUPAC name is N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]phthalazin-1-amine.
| Compound Name | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]phthalazin-1-amine |
|---|---|
| PubChem CID | 6148660 |
| Molecular Formula | C16H11ClN4O2 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]phthalazin-1-amine |
| SMILES | Clc1cc2c(cc1/C=N\Nc1nncc3ccccc13)OCO2 |
| InChI | InChI=1S/C16H11ClN4O2/c17-13-6-15-14(22-9-23-15)5-11(13)8-19-21-16-12-4-2-1-3-10(12)7-18-20-16/h1-8H,9H2,(H,20,21)/b19-8- |
| InChIKey | LNGQJVKUIAETHX-UWVJOHFNSA-N |
| XLogP | 3.46 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|