C14H10Cl2N2O2 — CID 154190515
3-chloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]aniline (PubChem CID 154190515) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 3-chloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]aniline.
| Compound Name | 3-chloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 154190515 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 3-chloro-N-[(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]aniline |
| SMILES | Clc1cccc(NN=Cc2cc3c(cc2Cl)OCO3)c1 |
| InChI | InChI=1S/C14H10Cl2N2O2/c15-10-2-1-3-11(5-10)18-17-7-9-4-13-14(6-12(9)16)20-8-19-13/h1-7,18H,8H2 |
| InChIKey | UZIOXWMIUQVMBL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|