C15H12ClN3O4 — CID 9069299
3-chloro-4-methyl-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]aniline (PubChem CID 9069299) has the molecular formula C15H12ClN3O4 and a molecular weight of 333.73 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]aniline.
| Compound Name | 3-chloro-4-methyl-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 9069299 |
| Molecular Formula | C15H12ClN3O4 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-chloro-4-methyl-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]aniline |
| SMILES | Cc1ccc(N/N=C\c2cc3c(cc2[N+](=O)[O-])OCO3)cc1Cl |
| InChI | InChI=1S/C15H12ClN3O4/c1-9-2-3-11(5-12(9)16)18-17-7-10-4-14-15(23-8-22-14)6-13(10)19(20)21/h2-7,18H,8H2,1H3/b17-7- |
| InChIKey | SJIIJFGHNUKLSH-IDUWFGFVSA-N |
| XLogP | 3.73 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|