C15H13Cl2N3O4 — CID 9058963
3,4-dichloro-N-[(Z)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]aniline (PubChem CID 9058963) has the molecular formula C15H13Cl2N3O4 and a molecular weight of 370.19 g/mol. Its IUPAC name is 3,4-dichloro-N-[(Z)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]aniline.
| Compound Name | 3,4-dichloro-N-[(Z)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 9058963 |
| Molecular Formula | C15H13Cl2N3O4 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 3,4-dichloro-N-[(Z)-(4,5-dimethoxy-2-nitrophenyl)methylideneamino]aniline |
| SMILES | COc1cc(/C=N\Nc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H13Cl2N3O4/c1-23-14-5-9(13(20(21)22)7-15(14)24-2)8-18-19-10-3-4-11(16)12(17)6-10/h3-8,19H,1-2H3/b18-8- |
| InChIKey | ZMURCCAMONAMKD-LSCVHKIXSA-N |
| XLogP | 4.36 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|