C15H13ClN2O4 — CID 139227482
N-(3-chlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine (PubChem CID 139227482) has the molecular formula C15H13ClN2O4 and a molecular weight of 320.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine.
| Compound Name | N-(3-chlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 139227482 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(3-chlorophenyl)-1-(4,5-dimethoxy-2-nitrophenyl)methanimine |
| SMILES | COc1cc(/C=N/c2cccc(Cl)c2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C15H13ClN2O4/c1-21-14-6-10(13(18(19)20)8-15(14)22-2)9-17-12-5-3-4-11(16)7-12/h3-9H,1-2H3/b17-9+ |
| InChIKey | MWOZRTPZHXPRLJ-RQZCQDPDSA-N |
| XLogP | 4.02 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|