C15H12ClN2O5- — CID 7606032
4-chloro-2-[(3,5-dimethoxyphenyl)iminomethyl]-6-nitrophenolate (PubChem CID 7606032) has the molecular formula C15H12ClN2O5- and a molecular weight of 335.72 g/mol. Its IUPAC name is 4-chloro-2-[(3,5-dimethoxyphenyl)iminomethyl]-6-nitrophenolate.
| Compound Name | 4-chloro-2-[(3,5-dimethoxyphenyl)iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7606032 |
| Molecular Formula | C15H12ClN2O5- |
| Molecular Weight | 335.72 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-chloro-2-[(3,5-dimethoxyphenyl)iminomethyl]-6-nitrophenolate |
| SMILES | COc1cc(/N=C/c2cc(Cl)cc([N+](=O)[O-])c2[O-])cc(OC)c1 |
| InChI | InChI=1S/C15H13ClN2O5/c1-22-12-5-11(6-13(7-12)23-2)17-8-9-3-10(16)4-14(15(9)19)18(20)21/h3-8,19H,1-2H3/p-1/b17-8+ |
| InChIKey | HOHXBBZSFYVCQX-CAOOACKPSA-M |
| XLogP | 3.09 |
| TPSA | 97.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|