C17H11ClN3O3S- — CID 7609712
4-chloro-2-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]iminomethyl]-6-nitrophenolate (PubChem CID 7609712) has the molecular formula C17H11ClN3O3S- and a molecular weight of 372.81 g/mol. Its IUPAC name is 4-chloro-2-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]iminomethyl]-6-nitrophenolate.
| Compound Name | 4-chloro-2-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 7609712 |
| Molecular Formula | C17H11ClN3O3S- |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 4-chloro-2-[[3-(2-methyl-1,3-thiazol-4-yl)phenyl]iminomethyl]-6-nitrophenolate |
| SMILES | Cc1nc(-c2cccc(/N=C/c3cc(Cl)cc([N+](=O)[O-])c3[O-])c2)cs1 |
| InChI | InChI=1S/C17H12ClN3O3S/c1-10-20-15(9-25-10)11-3-2-4-14(6-11)19-8-12-5-13(18)7-16(17(12)22)21(23)24/h2-9,22H,1H3/p-1/b19-8+ |
| InChIKey | SMOSDASPHQRACS-UFWORHAWSA-M |
| XLogP | 4.50 |
| TPSA | 91.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|