C20H17ClN5O3- — CID 7607334
4-chloro-2-nitro-6-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]iminomethyl]phenolate (PubChem CID 7607334) has the molecular formula C20H17ClN5O3- and a molecular weight of 410.84 g/mol. Its IUPAC name is 4-chloro-2-nitro-6-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]iminomethyl]phenolate.
| Compound Name | 4-chloro-2-nitro-6-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]iminomethyl]phenolate |
|---|---|
| PubChem CID | 7607334 |
| Molecular Formula | C20H17ClN5O3- |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-chloro-2-nitro-6-[[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]iminomethyl]phenolate |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(/C=N/c2cccc(-c3nnc4n3CCCCC4)c2)c1[O-] |
| InChI | InChI=1S/C20H18ClN5O3/c21-15-9-14(19(27)17(11-15)26(28)29)12-22-16-6-4-5-13(10-16)20-24-23-18-7-2-1-3-8-25(18)20/h4-6,9-12,27H,1-3,7-8H2/p-1/b22-12+ |
| InChIKey | XWUPYUXNJVMPCO-WSDLNYQXSA-M |
| XLogP | 4.06 |
| TPSA | 109.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|