C14H11Cl2N3O4 — CID 136704644
2-[[(3,4-dichlorophenyl)hydrazinylidene]methyl]-6-methoxy-4-nitrophenol (PubChem CID 136704644) has the molecular formula C14H11Cl2N3O4 and a molecular weight of 356.17 g/mol. Its IUPAC name is 2-[[(3,4-dichlorophenyl)hydrazinylidene]methyl]-6-methoxy-4-nitrophenol.
| Compound Name | 2-[[(3,4-dichlorophenyl)hydrazinylidene]methyl]-6-methoxy-4-nitrophenol |
|---|---|
| PubChem CID | 136704644 |
| Molecular Formula | C14H11Cl2N3O4 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 2-[[(3,4-dichlorophenyl)hydrazinylidene]methyl]-6-methoxy-4-nitrophenol |
| SMILES | COc1cc([N+](=O)[O-])cc(C=NNc2ccc(Cl)c(Cl)c2)c1O |
| InChI | InChI=1S/C14H11Cl2N3O4/c1-23-13-6-10(19(21)22)4-8(14(13)20)7-17-18-9-2-3-11(15)12(16)5-9/h2-7,18,20H,1H3 |
| InChIKey | GACXUMVSWVPBLQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|