C14H10BrClN2O2 — CID 9076539
N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-chloroaniline (PubChem CID 9076539) has the molecular formula C14H10BrClN2O2 and a molecular weight of 353.60 g/mol. Its IUPAC name is N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-chloroaniline.
| Compound Name | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-chloroaniline |
|---|---|
| PubChem CID | 9076539 |
| Molecular Formula | C14H10BrClN2O2 |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-3-chloroaniline |
| SMILES | Clc1cccc(N/N=C\c2cc3c(cc2Br)OCO3)c1 |
| InChI | InChI=1S/C14H10BrClN2O2/c15-12-6-14-13(19-8-20-14)4-9(12)7-17-18-11-3-1-2-10(16)5-11/h1-7,18H,8H2/b17-7- |
| InChIKey | IYOBLUXWIRAIDE-IDUWFGFVSA-N |
| XLogP | 4.28 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|