C10H10BrClN6O2 — CID 73449299
3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 73449299) has the molecular formula C10H10BrClN6O2 and a molecular weight of 361.59 g/mol. Its IUPAC name is 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 73449299 |
| Molecular Formula | C10H10BrClN6O2 |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cl.Nn1cnnc1NN=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C10H9BrN6O2.ClH/c11-7-2-9-8(18-5-19-9)1-6(7)3-13-15-10-16-14-4-17(10)12;/h1-4H,5,12H2,(H,15,16);1H |
| InChIKey | LOVAOXBVTBNZAY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|