C10H12N6 — CID 70617041
3-N-[(2-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 70617041) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 3-N-[(2-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(2-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 70617041 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 3-N-[(2-methylphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1ccccc1C=NNc1nncn1N |
| InChI | InChI=1S/C10H12N6/c1-8-4-2-3-5-9(8)6-12-14-10-15-13-7-16(10)11/h2-7H,11H2,1H3,(H,14,15) |
| InChIKey | DTEXXVVQXWNMBW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|