C12H15Cl2N7 — CID 137153076
3-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride (PubChem CID 137153076) has the molecular formula C12H15Cl2N7 and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride.
| Compound Name | 3-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 137153076 |
| Molecular Formula | C12H15Cl2N7 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/Nc1nncn1N.Cl.Cl |
| InChI | InChI=1S/C12H13N7.2ClH/c1-8-10(9-4-2-3-5-11(9)16-8)6-14-17-12-18-15-7-19(12)13;;/h2-7,16H,13H2,1H3,(H,17,18);2*1H/b14-6+;; |
| InChIKey | DGBOXCGKNVRNLX-OJHGAHPXSA-N |
| XLogP | 2.07 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|