C9H9IN6 — CID 73253730
3-N-[(E)-(2-iodophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 73253730) has the molecular formula C9H9IN6 and a molecular weight of 328.12 g/mol. Its IUPAC name is 3-N-[(E)-(2-iodophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(E)-(2-iodophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 73253730 |
| Molecular Formula | C9H9IN6 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 3-N-[(E)-(2-iodophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1cnnc1N/N=C/c1ccccc1I |
| InChI | InChI=1S/C9H9IN6/c10-8-4-2-1-3-7(8)5-12-14-9-15-13-6-16(9)11/h1-6H,11H2,(H,14,15)/b12-5+ |
| InChIKey | INQMMILERZPKKI-LFYBBSHMSA-N |
| XLogP | 1.04 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|