C17H20Cl2N6O2 — CID 45042745
3-N-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride (PubChem CID 45042745) has the molecular formula C17H20Cl2N6O2 and a molecular weight of 411.29 g/mol. Its IUPAC name is 3-N-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride.
| Compound Name | 3-N-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 45042745 |
| Molecular Formula | C17H20Cl2N6O2 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-N-[(E)-(3-methoxy-2-phenylmethoxyphenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
| SMILES | COc1cccc(/C=N/Nc2nncn2N)c1OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H18N6O2.2ClH/c1-24-15-9-5-8-14(10-19-21-17-22-20-12-23(17)18)16(15)25-11-13-6-3-2-4-7-13;;/h2-10,12H,11,18H2,1H3,(H,21,22);2*1H/b19-10+;; |
| InChIKey | WWOIHVNJYGUMBZ-DLFBYYCRSA-N |
| XLogP | 2.87 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|