C9H9Cl3N6 — CID 24762015
3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 24762015) has the molecular formula C9H9Cl3N6 and a molecular weight of 307.57 g/mol. Its IUPAC name is 3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 24762015 |
| Molecular Formula | C9H9Cl3N6 |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-N-[(2,4-dichlorophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cl.Nn1cnnc1NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2N6.ClH/c10-7-2-1-6(8(11)3-7)4-13-15-9-16-14-5-17(9)12;/h1-5H,12H2,(H,15,16);1H |
| InChIKey | JQBCNIPKYZYSGP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|