C15H16N4S — CID 136822328
4,5-dimethyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 136822328) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 4,5-dimethyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4,5-dimethyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 136822328 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4,5-dimethyl-N-[(Z)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N/N=C\c2c(C)[nH]c3ccccc23)sc1C |
| InChI | InChI=1S/C15H16N4S/c1-9-11(3)20-15(18-9)19-16-8-13-10(2)17-14-7-5-4-6-12(13)14/h4-8,17H,1-3H3,(H,18,19)/b16-8- |
| InChIKey | NZIVPKGCPGCHHJ-PXNMLYILSA-N |
| XLogP | 4.00 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|